C14H20N2O3S — CID 9053736
methyl 4-[(2-methoxyphenyl)methylcarbamothioylamino]butanoate (PubChem CID 9053736) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is methyl 4-[(2-methoxyphenyl)methylcarbamothioylamino]butanoate.
| Compound Name | methyl 4-[(2-methoxyphenyl)methylcarbamothioylamino]butanoate |
|---|---|
| PubChem CID | 9053736 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | methyl 4-[(2-methoxyphenyl)methylcarbamothioylamino]butanoate |
| SMILES | COC(=O)CCCNC(=S)NCc1ccccc1OC |
| InChI | InChI=1S/C14H20N2O3S/c1-18-12-7-4-3-6-11(12)10-16-14(20)15-9-5-8-13(17)19-2/h3-4,6-7H,5,8-10H2,1-2H3,(H2,15,16,20) |
| InChIKey | ADHYRXLKVCPOQJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|