C16H23N3O3S — CID 9094963
methyl 4-[[2-(2-ethylanilino)-2-oxoethyl]carbamothioylamino]butanoate (PubChem CID 9094963) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is methyl 4-[[2-(2-ethylanilino)-2-oxoethyl]carbamothioylamino]butanoate.
| Compound Name | methyl 4-[[2-(2-ethylanilino)-2-oxoethyl]carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 9094963 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | methyl 4-[[2-(2-ethylanilino)-2-oxoethyl]carbamothioylamino]butanoate |
| SMILES | CCc1ccccc1NC(=O)CNC(=S)NCCCC(=O)OC |
| InChI | InChI=1S/C16H23N3O3S/c1-3-12-7-4-5-8-13(12)19-14(20)11-18-16(23)17-10-6-9-15(21)22-2/h4-5,7-8H,3,6,9-11H2,1-2H3,(H,19,20)(H2,17,18,23) |
| InChIKey | QUUNUVLQXPXDQY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|