C20H24N2O3 — CID 75436256
methyl 5-[[2-(benzylamino)benzoyl]amino]pentanoate (PubChem CID 75436256) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is methyl 5-[[2-(benzylamino)benzoyl]amino]pentanoate.
| Compound Name | methyl 5-[[2-(benzylamino)benzoyl]amino]pentanoate |
|---|---|
| PubChem CID | 75436256 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | methyl 5-[[2-(benzylamino)benzoyl]amino]pentanoate |
| SMILES | COC(=O)CCCCNC(=O)c1ccccc1NCc1ccccc1 |
| InChI | InChI=1S/C20H24N2O3/c1-25-19(23)13-7-8-14-21-20(24)17-11-5-6-12-18(17)22-15-16-9-3-2-4-10-16/h2-6,9-12,22H,7-8,13-15H2,1H3,(H,21,24) |
| InChIKey | WUSQXBKZTLZIPV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|