C15H16FN2OPS — CID 142879634
1-(3-fluoro-4-hydroxy-5-phosphanylphenyl)-3-[(2-methylphenyl)methyl]thiourea (PubChem CID 142879634) has the molecular formula C15H16FN2OPS and a molecular weight of 322.35 g/mol. Its IUPAC name is 1-(3-fluoro-4-hydroxy-5-phosphanylphenyl)-3-[(2-methylphenyl)methyl]thiourea.
| Compound Name | 1-(3-fluoro-4-hydroxy-5-phosphanylphenyl)-3-[(2-methylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 142879634 |
| Molecular Formula | C15H16FN2OPS |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 1-(3-fluoro-4-hydroxy-5-phosphanylphenyl)-3-[(2-methylphenyl)methyl]thiourea |
| SMILES | Cc1ccccc1CNC(=S)Nc1cc(F)c(O)c(P)c1 |
| InChI | InChI=1S/C15H16FN2OPS/c1-9-4-2-3-5-10(9)8-17-15(21)18-11-6-12(16)14(19)13(20)7-11/h2-7,19H,8,20H2,1H3,(H2,17,18,21) |
| InChIKey | FHBHFBUPCQIOBN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|