C20H26FN3S — CID 8560143
1-[[2-(diethylaminomethyl)phenyl]methyl]-3-(3-fluoro-4-methylphenyl)thiourea (PubChem CID 8560143) has the molecular formula C20H26FN3S and a molecular weight of 359.51 g/mol. Its IUPAC name is 1-[[2-(diethylaminomethyl)phenyl]methyl]-3-(3-fluoro-4-methylphenyl)thiourea.
| Compound Name | 1-[[2-(diethylaminomethyl)phenyl]methyl]-3-(3-fluoro-4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 8560143 |
| Molecular Formula | C20H26FN3S |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 1-[[2-(diethylaminomethyl)phenyl]methyl]-3-(3-fluoro-4-methylphenyl)thiourea |
| SMILES | CCN(CC)Cc1ccccc1CNC(=S)Nc1ccc(C)c(F)c1 |
| InChI | InChI=1S/C20H26FN3S/c1-4-24(5-2)14-17-9-7-6-8-16(17)13-22-20(25)23-18-11-10-15(3)19(21)12-18/h6-12H,4-5,13-14H2,1-3H3,(H2,22,23,25) |
| InChIKey | WVTAUXUCGAIACG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|