C16H15F2N3OS — CID 8771439
2-(benzylcarbamothioylamino)-N-(3,4-difluorophenyl)acetamide (PubChem CID 8771439) has the molecular formula C16H15F2N3OS and a molecular weight of 335.38 g/mol. Its IUPAC name is 2-(benzylcarbamothioylamino)-N-(3,4-difluorophenyl)acetamide.
| Compound Name | 2-(benzylcarbamothioylamino)-N-(3,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 8771439 |
| Molecular Formula | C16H15F2N3OS |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 2-(benzylcarbamothioylamino)-N-(3,4-difluorophenyl)acetamide |
| SMILES | O=C(CNC(=S)NCc1ccccc1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H15F2N3OS/c17-13-7-6-12(8-14(13)18)21-15(22)10-20-16(23)19-9-11-4-2-1-3-5-11/h1-8H,9-10H2,(H,21,22)(H2,19,20,23) |
| InChIKey | VKMIAPWVNBFQNZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|