C19H21F2N3O2 — CID 8563869
2-[[2-[benzyl(ethyl)amino]acetyl]amino]-N-(3,4-difluorophenyl)acetamide (PubChem CID 8563869) has the molecular formula C19H21F2N3O2 and a molecular weight of 361.39 g/mol. Its IUPAC name is 2-[[2-[benzyl(ethyl)amino]acetyl]amino]-N-(3,4-difluorophenyl)acetamide.
| Compound Name | 2-[[2-[benzyl(ethyl)amino]acetyl]amino]-N-(3,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 8563869 |
| Molecular Formula | C19H21F2N3O2 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2-[[2-[benzyl(ethyl)amino]acetyl]amino]-N-(3,4-difluorophenyl)acetamide |
| SMILES | CCN(CC(=O)NCC(=O)Nc1ccc(F)c(F)c1)Cc1ccccc1 |
| InChI | InChI=1S/C19H21F2N3O2/c1-2-24(12-14-6-4-3-5-7-14)13-19(26)22-11-18(25)23-15-8-9-16(20)17(21)10-15/h3-10H,2,11-13H2,1H3,(H,22,26)(H,23,25) |
| InChIKey | FVWYORWHCTZNDG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |