C11H12N4O2 — CID 24618527
N'-[(2E,4E)-hexa-2,4-dienoyl]pyrazine-2-carbohydrazide (PubChem CID 24618527) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is N'-[(2E,4E)-hexa-2,4-dienoyl]pyrazine-2-carbohydrazide.
| Compound Name | N'-[(2E,4E)-hexa-2,4-dienoyl]pyrazine-2-carbohydrazide |
|---|---|
| PubChem CID | 24618527 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | N'-[(2E,4E)-hexa-2,4-dienoyl]pyrazine-2-carbohydrazide |
| SMILES | C/C=C/C=C/C(=O)NNC(=O)c1cnccn1 |
| InChI | InChI=1S/C11H12N4O2/c1-2-3-4-5-10(16)14-15-11(17)9-8-12-6-7-13-9/h2-8H,1H3,(H,14,16)(H,15,17)/b3-2+,5-4+ |
| InChIKey | VOXHLQQLDNFMSC-MQQKCMAXSA-N |
| XLogP | 0.37 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|