C15H16N4O5 — CID 42016001
N'-(2,4,5-trimethoxybenzoyl)pyrazine-2-carbohydrazide (PubChem CID 42016001) has the molecular formula C15H16N4O5 and a molecular weight of 332.32 g/mol. Its IUPAC name is N'-(2,4,5-trimethoxybenzoyl)pyrazine-2-carbohydrazide.
| Compound Name | N'-(2,4,5-trimethoxybenzoyl)pyrazine-2-carbohydrazide |
|---|---|
| PubChem CID | 42016001 |
| Molecular Formula | C15H16N4O5 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | N'-(2,4,5-trimethoxybenzoyl)pyrazine-2-carbohydrazide |
| SMILES | COc1cc(OC)c(C(=O)NNC(=O)c2cnccn2)cc1OC |
| InChI | InChI=1S/C15H16N4O5/c1-22-11-7-13(24-3)12(23-2)6-9(11)14(20)18-19-15(21)10-8-16-4-5-17-10/h4-8H,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | REUKGJXFEWWYCN-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|