C16H18N4O4 — CID 42016381
N'-[3-(3,5-dimethoxyphenyl)propanoyl]pyrazine-2-carbohydrazide (PubChem CID 42016381) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is N'-[3-(3,5-dimethoxyphenyl)propanoyl]pyrazine-2-carbohydrazide.
| Compound Name | N'-[3-(3,5-dimethoxyphenyl)propanoyl]pyrazine-2-carbohydrazide |
|---|---|
| PubChem CID | 42016381 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | N'-[3-(3,5-dimethoxyphenyl)propanoyl]pyrazine-2-carbohydrazide |
| SMILES | COc1cc(CCC(=O)NNC(=O)c2cnccn2)cc(OC)c1 |
| InChI | InChI=1S/C16H18N4O4/c1-23-12-7-11(8-13(9-12)24-2)3-4-15(21)19-20-16(22)14-10-17-5-6-18-14/h5-10H,3-4H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | WNPKMJPCLSQJFT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|