C20H25N3O4 — CID 22829646
3-(3,5-dimethoxyphenyl)-N'-[2-(4-methylanilino)acetyl]propanehydrazide (PubChem CID 22829646) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-N'-[2-(4-methylanilino)acetyl]propanehydrazide.
| Compound Name | 3-(3,5-dimethoxyphenyl)-N'-[2-(4-methylanilino)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 22829646 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-N'-[2-(4-methylanilino)acetyl]propanehydrazide |
| SMILES | COc1cc(CCC(=O)NNC(=O)CNc2ccc(C)cc2)cc(OC)c1 |
| InChI | InChI=1S/C20H25N3O4/c1-14-4-7-16(8-5-14)21-13-20(25)23-22-19(24)9-6-15-10-17(26-2)12-18(11-15)27-3/h4-5,7-8,10-12,21H,6,9,13H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | KLDATRFAIHKQEN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|