C15H10ClF3N4O2 — CID 71899796
N'-[3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enoyl]pyrazine-2-carbohydrazide (PubChem CID 71899796) has the molecular formula C15H10ClF3N4O2 and a molecular weight of 370.72 g/mol. Its IUPAC name is N'-[3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enoyl]pyrazine-2-carbohydrazide.
| Compound Name | N'-[3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enoyl]pyrazine-2-carbohydrazide |
|---|---|
| PubChem CID | 71899796 |
| Molecular Formula | C15H10ClF3N4O2 |
| Molecular Weight | 370.72 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | N'-[3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enoyl]pyrazine-2-carbohydrazide |
| SMILES | O=C(C=Cc1ccc(Cl)c(C(F)(F)F)c1)NNC(=O)c1cnccn1 |
| InChI | InChI=1S/C15H10ClF3N4O2/c16-11-3-1-9(7-10(11)15(17,18)19)2-4-13(24)22-23-14(25)12-8-20-5-6-21-12/h1-8H,(H,22,24)(H,23,25) |
| InChIKey | ZBWVAEMFOXNVNJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.72 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|