C18H20BrN3O4 — CID 24533069
4-bromo-N'-(3,4-dimethoxy-5-prop-2-enylbenzoyl)-1-methylpyrrole-2-carbohydrazide (PubChem CID 24533069) has the molecular formula C18H20BrN3O4 and a molecular weight of 422.28 g/mol. Its IUPAC name is 4-bromo-N'-(3,4-dimethoxy-5-prop-2-enylbenzoyl)-1-methylpyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-(3,4-dimethoxy-5-prop-2-enylbenzoyl)-1-methylpyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 24533069 |
| Molecular Formula | C18H20BrN3O4 |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | 4-bromo-N'-(3,4-dimethoxy-5-prop-2-enylbenzoyl)-1-methylpyrrole-2-carbohydrazide |
| SMILES | C=CCc1cc(C(=O)NNC(=O)c2cc(Br)cn2C)cc(OC)c1OC |
| InChI | InChI=1S/C18H20BrN3O4/c1-5-6-11-7-12(8-15(25-3)16(11)26-4)17(23)20-21-18(24)14-9-13(19)10-22(14)2/h5,7-10H,1,6H2,2-4H3,(H,20,23)(H,21,24) |
| InChIKey | NGGKSOJGPOOSHX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|