C16H23BrN4O3 — CID 32814392
N'-(4-bromo-1-methylpyrrole-2-carbonyl)-1-(2-methylpropanoyl)piperidine-4-carbohydrazide (PubChem CID 32814392) has the molecular formula C16H23BrN4O3 and a molecular weight of 399.29 g/mol. Its IUPAC name is N'-(4-bromo-1-methylpyrrole-2-carbonyl)-1-(2-methylpropanoyl)piperidine-4-carbohydrazide.
| Compound Name | N'-(4-bromo-1-methylpyrrole-2-carbonyl)-1-(2-methylpropanoyl)piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 32814392 |
| Molecular Formula | C16H23BrN4O3 |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | N'-(4-bromo-1-methylpyrrole-2-carbonyl)-1-(2-methylpropanoyl)piperidine-4-carbohydrazide |
| SMILES | CC(C)C(=O)N1CCC(C(=O)NNC(=O)c2cc(Br)cn2C)CC1 |
| InChI | InChI=1S/C16H23BrN4O3/c1-10(2)16(24)21-6-4-11(5-7-21)14(22)18-19-15(23)13-8-12(17)9-20(13)3/h8-11H,4-7H2,1-3H3,(H,18,22)(H,19,23) |
| InChIKey | LTCQIVLIRVUULK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|