C18H25BrN4O3 — CID 55738672
4-bromo-N'-[1-(cyclohexanecarbonyl)pyrrolidine-2-carbonyl]-1-methylpyrrole-2-carbohydrazide (PubChem CID 55738672) has the molecular formula C18H25BrN4O3 and a molecular weight of 425.33 g/mol. Its IUPAC name is 4-bromo-N'-[1-(cyclohexanecarbonyl)pyrrolidine-2-carbonyl]-1-methylpyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-[1-(cyclohexanecarbonyl)pyrrolidine-2-carbonyl]-1-methylpyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 55738672 |
| Molecular Formula | C18H25BrN4O3 |
| Molecular Weight | 425.33 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 4-bromo-N'-[1-(cyclohexanecarbonyl)pyrrolidine-2-carbonyl]-1-methylpyrrole-2-carbohydrazide |
| SMILES | Cn1cc(Br)cc1C(=O)NNC(=O)C1CCCN1C(=O)C1CCCCC1 |
| InChI | InChI=1S/C18H25BrN4O3/c1-22-11-13(19)10-15(22)17(25)21-20-16(24)14-8-5-9-23(14)18(26)12-6-3-2-4-7-12/h10-12,14H,2-9H2,1H3,(H,20,24)(H,21,25) |
| InChIKey | JCOSTCLWWRGCHI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|