C10H14BrN3O3S — CID 99837354
4-bromo-1-methyl-N-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide (PubChem CID 99837354) has the molecular formula C10H14BrN3O3S and a molecular weight of 336.21 g/mol. Its IUPAC name is 4-bromo-1-methyl-N-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-1-methyl-N-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 99837354 |
| Molecular Formula | C10H14BrN3O3S |
| Molecular Weight | 336.21 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | 4-bromo-1-methyl-N-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide |
| SMILES | Cn1cc(Br)cc1C(=O)NS(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C10H14BrN3O3S/c1-13-7-8(11)6-9(13)10(15)12-18(16,17)14-4-2-3-5-14/h6-7H,2-5H2,1H3,(H,12,15) |
| InChIKey | MKNHFLGAXLYULT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.21 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |