C11H17BrN4O — CID 115279131
4-bromo-1-methyl-N-(4-methylpiperazin-1-yl)pyrrole-2-carboxamide (PubChem CID 115279131) has the molecular formula C11H17BrN4O and a molecular weight of 301.19 g/mol. Its IUPAC name is 4-bromo-1-methyl-N-(4-methylpiperazin-1-yl)pyrrole-2-carboxamide.
| Compound Name | 4-bromo-1-methyl-N-(4-methylpiperazin-1-yl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 115279131 |
| Molecular Formula | C11H17BrN4O |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 4-bromo-1-methyl-N-(4-methylpiperazin-1-yl)pyrrole-2-carboxamide |
| SMILES | CN1CCN(NC(=O)c2cc(Br)cn2C)CC1 |
| InChI | InChI=1S/C11H17BrN4O/c1-14-3-5-16(6-4-14)13-11(17)10-7-9(12)8-15(10)2/h7-8H,3-6H2,1-2H3,(H,13,17) |
| InChIKey | QHKNOPCITONSEV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |