C23H16F2N2O4S — CID 30257558
[4-(thiophene-2-carbonylamino)phenyl] 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoate (PubChem CID 30257558) has the molecular formula C23H16F2N2O4S and a molecular weight of 454.45 g/mol. Its IUPAC name is [4-(thiophene-2-carbonylamino)phenyl] 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoate.
| Compound Name | [4-(thiophene-2-carbonylamino)phenyl] 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoate |
|---|---|
| PubChem CID | 30257558 |
| Molecular Formula | C23H16F2N2O4S |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | [4-(thiophene-2-carbonylamino)phenyl] 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoate |
| SMILES | O=C(CCc1ncc(-c2ccc(F)cc2F)o1)Oc1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C23H16F2N2O4S/c24-14-3-8-17(18(25)12-14)19-13-26-21(31-19)9-10-22(28)30-16-6-4-15(5-7-16)27-23(29)20-2-1-11-32-20/h1-8,11-13H,9-10H2,(H,27,29) |
| InChIKey | GDHPQHLHFCORGG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|