C20H14F2N2O4 — CID 16597254
(4-cyano-2-methoxyphenyl) 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoate (PubChem CID 16597254) has the molecular formula C20H14F2N2O4 and a molecular weight of 384.34 g/mol. Its IUPAC name is (4-cyano-2-methoxyphenyl) 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoate.
| Compound Name | (4-cyano-2-methoxyphenyl) 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoate |
|---|---|
| PubChem CID | 16597254 |
| Molecular Formula | C20H14F2N2O4 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | (4-cyano-2-methoxyphenyl) 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoate |
| SMILES | COc1cc(C#N)ccc1OC(=O)CCc1ncc(-c2ccc(F)cc2F)o1 |
| InChI | InChI=1S/C20H14F2N2O4/c1-26-17-8-12(10-23)2-5-16(17)28-20(25)7-6-19-24-11-18(27-19)14-4-3-13(21)9-15(14)22/h2-5,8-9,11H,6-7H2,1H3 |
| InChIKey | XESGUWWDLNMXPN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|