C22H18FN3O2 — CID 38886258
4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-naphthalen-1-ylbutanamide (PubChem CID 38886258) has the molecular formula C22H18FN3O2 and a molecular weight of 375.40 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-naphthalen-1-ylbutanamide.
| Compound Name | 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-naphthalen-1-ylbutanamide |
|---|---|
| PubChem CID | 38886258 |
| Molecular Formula | C22H18FN3O2 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-naphthalen-1-ylbutanamide |
| SMILES | O=C(CCCc1nc(-c2ccc(F)cc2)no1)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C22H18FN3O2/c23-17-13-11-16(12-14-17)22-25-21(28-26-22)10-4-9-20(27)24-19-8-3-6-15-5-1-2-7-18(15)19/h1-3,5-8,11-14H,4,9-10H2,(H,24,27) |
| InChIKey | CXFPXJSQCIMZJN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |