C22H22FN3O2 — CID 46453328
4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-(5,6,7,8-tetrahydronaphthalen-1-yl)butanamide (PubChem CID 46453328) has the molecular formula C22H22FN3O2 and a molecular weight of 379.44 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-(5,6,7,8-tetrahydronaphthalen-1-yl)butanamide.
| Compound Name | 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-(5,6,7,8-tetrahydronaphthalen-1-yl)butanamide |
|---|---|
| PubChem CID | 46453328 |
| Molecular Formula | C22H22FN3O2 |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-(5,6,7,8-tetrahydronaphthalen-1-yl)butanamide |
| SMILES | O=C(CCCc1nc(-c2ccc(F)cc2)no1)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C22H22FN3O2/c23-17-13-11-16(12-14-17)22-25-21(28-26-22)10-4-9-20(27)24-19-8-3-6-15-5-1-2-7-18(15)19/h3,6,8,11-14H,1-2,4-5,7,9-10H2,(H,24,27) |
| InChIKey | DOLSLMKOVCBYBG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |