C19H18N2O3 — CID 9192024
(2,6-dimethylphenyl) 3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoate (PubChem CID 9192024) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is (2,6-dimethylphenyl) 3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoate.
| Compound Name | (2,6-dimethylphenyl) 3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoate |
|---|---|
| PubChem CID | 9192024 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | (2,6-dimethylphenyl) 3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanoate |
| SMILES | Cc1cccc(C)c1OC(=O)CCc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C19H18N2O3/c1-13-7-6-8-14(2)18(13)23-17(22)12-11-16-20-19(21-24-16)15-9-4-3-5-10-15/h3-10H,11-12H2,1-2H3 |
| InChIKey | XEJLFFBNCXZWLF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|