C11H9Cl2FN2O — CID 63092416
3-(3-chloro-4-fluorophenyl)-5-(3-chloropropyl)-1,2,4-oxadiazole (PubChem CID 63092416) has the molecular formula C11H9Cl2FN2O and a molecular weight of 275.11 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-5-(3-chloropropyl)-1,2,4-oxadiazole.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-5-(3-chloropropyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 63092416 |
| Molecular Formula | C11H9Cl2FN2O |
| Molecular Weight | 275.11 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-5-(3-chloropropyl)-1,2,4-oxadiazole |
| SMILES | Fc1ccc(-c2noc(CCCCl)n2)cc1Cl |
| InChI | InChI=1S/C11H9Cl2FN2O/c12-5-1-2-10-15-11(16-17-10)7-3-4-9(14)8(13)6-7/h3-4,6H,1-2,5H2 |
| InChIKey | LGGSQETUINWORB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.11 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|