C10H7ClF2N2O — CID 43658624
5-(2-chloroethyl)-3-(3,4-difluorophenyl)-1,2,4-oxadiazole (PubChem CID 43658624) has the molecular formula C10H7ClF2N2O and a molecular weight of 244.63 g/mol. Its IUPAC name is 5-(2-chloroethyl)-3-(3,4-difluorophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-(2-chloroethyl)-3-(3,4-difluorophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 43658624 |
| Molecular Formula | C10H7ClF2N2O |
| Molecular Weight | 244.63 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 5-(2-chloroethyl)-3-(3,4-difluorophenyl)-1,2,4-oxadiazole |
| SMILES | Fc1ccc(-c2noc(CCCl)n2)cc1F |
| InChI | InChI=1S/C10H7ClF2N2O/c11-4-3-9-14-10(15-16-9)6-1-2-7(12)8(13)5-6/h1-2,5H,3-4H2 |
| InChIKey | WIYRTZHKDDYLTK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.63 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|