C11H10FNO2 — CID 82048699
[5-(4-fluoro-3-methylphenyl)-1,2-oxazol-3-yl]methanol (PubChem CID 82048699) has the molecular formula C11H10FNO2 and a molecular weight of 207.20 g/mol. Its IUPAC name is [5-(4-fluoro-3-methylphenyl)-1,2-oxazol-3-yl]methanol.
| Compound Name | [5-(4-fluoro-3-methylphenyl)-1,2-oxazol-3-yl]methanol |
|---|---|
| PubChem CID | 82048699 |
| Molecular Formula | C11H10FNO2 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | [5-(4-fluoro-3-methylphenyl)-1,2-oxazol-3-yl]methanol |
| SMILES | Cc1cc(-c2cc(CO)no2)ccc1F |
| InChI | InChI=1S/C11H10FNO2/c1-7-4-8(2-3-10(7)12)11-5-9(6-14)13-15-11/h2-5,14H,6H2,1H3 |
| InChIKey | QCUSZHFGDYOTKK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |