C15H11NO3 — CID 135855877
3-[3-(4-hydroxyphenyl)-1,2-oxazol-5-yl]phenol (PubChem CID 135855877) has the molecular formula C15H11NO3 and a molecular weight of 253.26 g/mol. Its IUPAC name is 3-[3-(4-hydroxyphenyl)-1,2-oxazol-5-yl]phenol.
| Compound Name | 3-[3-(4-hydroxyphenyl)-1,2-oxazol-5-yl]phenol |
|---|---|
| PubChem CID | 135855877 |
| Molecular Formula | C15H11NO3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 3-[3-(4-hydroxyphenyl)-1,2-oxazol-5-yl]phenol |
| SMILES | Oc1ccc(-c2cc(-c3cccc(O)c3)on2)cc1 |
| InChI | InChI=1S/C15H11NO3/c17-12-6-4-10(5-7-12)14-9-15(19-16-14)11-2-1-3-13(18)8-11/h1-9,17-18H |
| InChIKey | ZYSCCHLCNRGGTO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |