C14H14N4O2 — CID 96667520
6-(6-amino-2-methylpyrimidin-4-yl)-4-methyl-1,4-benzoxazin-3-one (PubChem CID 96667520) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 6-(6-amino-2-methylpyrimidin-4-yl)-4-methyl-1,4-benzoxazin-3-one.
| Compound Name | 6-(6-amino-2-methylpyrimidin-4-yl)-4-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 96667520 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 6-(6-amino-2-methylpyrimidin-4-yl)-4-methyl-1,4-benzoxazin-3-one |
| SMILES | Cc1nc(N)cc(-c2ccc3c(c2)N(C)C(=O)CO3)n1 |
| InChI | InChI=1S/C14H14N4O2/c1-8-16-10(6-13(15)17-8)9-3-4-12-11(5-9)18(2)14(19)7-20-12/h3-6H,7H2,1-2H3,(H2,15,16,17) |
| InChIKey | FTWAKKDKYRKLAY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |