C22H23N3O2 — CID 90868639
6-(2-anilino-4-pyridinyl)-4-methyl-1,4-benzoxazin-3-one;ethane (PubChem CID 90868639) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 6-(2-anilino-4-pyridinyl)-4-methyl-1,4-benzoxazin-3-one;ethane.
| Compound Name | 6-(2-anilino-4-pyridinyl)-4-methyl-1,4-benzoxazin-3-one;ethane |
|---|---|
| PubChem CID | 90868639 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 6-(2-anilino-4-pyridinyl)-4-methyl-1,4-benzoxazin-3-one;ethane |
| SMILES | CC.CN1C(=O)COc2ccc(-c3ccnc(Nc4ccccc4)c3)cc21 |
| InChI | InChI=1S/C20H17N3O2.C2H6/c1-23-17-11-14(7-8-18(17)25-13-20(23)24)15-9-10-21-19(12-15)22-16-5-3-2-4-6-16;1-2/h2-12H,13H2,1H3,(H,21,22);1-2H3 |
| InChIKey | JKFCEKHLRALXTI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |