C15H15N7O2 — CID 70901028
6-[(3,8-diaminoimidazo[1,2-b]pyridazin-6-yl)amino]-4-methyl-1,4-benzoxazin-3-one (PubChem CID 70901028) has the molecular formula C15H15N7O2 and a molecular weight of 325.33 g/mol. Its IUPAC name is 6-[(3,8-diaminoimidazo[1,2-b]pyridazin-6-yl)amino]-4-methyl-1,4-benzoxazin-3-one.
| Compound Name | 6-[(3,8-diaminoimidazo[1,2-b]pyridazin-6-yl)amino]-4-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 70901028 |
| Molecular Formula | C15H15N7O2 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 6-[(3,8-diaminoimidazo[1,2-b]pyridazin-6-yl)amino]-4-methyl-1,4-benzoxazin-3-one |
| SMILES | CN1C(=O)COc2ccc(Nc3cc(N)c4ncc(N)n4n3)cc21 |
| InChI | InChI=1S/C15H15N7O2/c1-21-10-4-8(2-3-11(10)24-7-14(21)23)19-13-5-9(16)15-18-6-12(17)22(15)20-13/h2-6H,7,16-17H2,1H3,(H,19,20) |
| InChIKey | WLEHMBVXIPGMAD-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 123.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|