C16H15NO2 — CID 117001136
4-methyl-7-(3-methylphenyl)-1,4-benzoxazin-3-one (PubChem CID 117001136) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 4-methyl-7-(3-methylphenyl)-1,4-benzoxazin-3-one.
| Compound Name | 4-methyl-7-(3-methylphenyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 117001136 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 4-methyl-7-(3-methylphenyl)-1,4-benzoxazin-3-one |
| SMILES | Cc1cccc(-c2ccc3c(c2)OCC(=O)N3C)c1 |
| InChI | InChI=1S/C16H15NO2/c1-11-4-3-5-12(8-11)13-6-7-14-15(9-13)19-10-16(18)17(14)2/h3-9H,10H2,1-2H3 |
| InChIKey | QMJBIIUTVKBMKR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |