C11H12N4O3 — CID 10610532
N-(diaminomethylidene)-4-methyl-3-oxo-1,4-benzoxazine-7-carboxamide (PubChem CID 10610532) has the molecular formula C11H12N4O3 and a molecular weight of 248.24 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-methyl-3-oxo-1,4-benzoxazine-7-carboxamide.
| Compound Name | N-(diaminomethylidene)-4-methyl-3-oxo-1,4-benzoxazine-7-carboxamide |
|---|---|
| PubChem CID | 10610532 |
| Molecular Formula | C11H12N4O3 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | N-(diaminomethylidene)-4-methyl-3-oxo-1,4-benzoxazine-7-carboxamide |
| SMILES | CN1C(=O)COc2cc(C(=O)N=C(N)N)ccc21 |
| InChI | InChI=1S/C11H12N4O3/c1-15-7-3-2-6(10(17)14-11(12)13)4-8(7)18-5-9(15)16/h2-4H,5H2,1H3,(H4,12,13,14,17) |
| InChIKey | STWGWXBSKONDGQ-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|