C16H16N2O2 — CID 116994811
7-[4-(aminomethyl)phenyl]-4-methyl-1,4-benzoxazin-3-one (PubChem CID 116994811) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 7-[4-(aminomethyl)phenyl]-4-methyl-1,4-benzoxazin-3-one.
| Compound Name | 7-[4-(aminomethyl)phenyl]-4-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 116994811 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 7-[4-(aminomethyl)phenyl]-4-methyl-1,4-benzoxazin-3-one |
| SMILES | CN1C(=O)COc2cc(-c3ccc(CN)cc3)ccc21 |
| InChI | InChI=1S/C16H16N2O2/c1-18-14-7-6-13(8-15(14)20-10-16(18)19)12-4-2-11(9-17)3-5-12/h2-8H,9-10,17H2,1H3 |
| InChIKey | IHVVLQGMSXALPN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |