C13H16N2O3 — CID 82338806
7-(aminomethyl)-4-(3-oxobutan-2-yl)-1,4-benzoxazin-3-one (PubChem CID 82338806) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 7-(aminomethyl)-4-(3-oxobutan-2-yl)-1,4-benzoxazin-3-one.
| Compound Name | 7-(aminomethyl)-4-(3-oxobutan-2-yl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82338806 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 7-(aminomethyl)-4-(3-oxobutan-2-yl)-1,4-benzoxazin-3-one |
| SMILES | CC(=O)C(C)N1C(=O)COc2cc(CN)ccc21 |
| InChI | InChI=1S/C13H16N2O3/c1-8(9(2)16)15-11-4-3-10(6-14)5-12(11)18-7-13(15)17/h3-5,8H,6-7,14H2,1-2H3 |
| InChIKey | LOIIBWGIFUGVDL-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |