C16H16N2O2 — CID 82212148
7-(benzylamino)-4-methyl-1,4-benzoxazin-3-one (PubChem CID 82212148) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 7-(benzylamino)-4-methyl-1,4-benzoxazin-3-one.
| Compound Name | 7-(benzylamino)-4-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82212148 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 7-(benzylamino)-4-methyl-1,4-benzoxazin-3-one |
| SMILES | CN1C(=O)COc2cc(NCc3ccccc3)ccc21 |
| InChI | InChI=1S/C16H16N2O2/c1-18-14-8-7-13(9-15(14)20-11-16(18)19)17-10-12-5-3-2-4-6-12/h2-9,17H,10-11H2,1H3 |
| InChIKey | VTWOBVYBMUZMQP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |