C17H26N2O5S — CID 75451639
1-(benzenesulfonyl)-N-[3-(2-hydroxyethoxy)propyl]piperidine-3-carboxamide (PubChem CID 75451639) has the molecular formula C17H26N2O5S and a molecular weight of 370.47 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[3-(2-hydroxyethoxy)propyl]piperidine-3-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[3-(2-hydroxyethoxy)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 75451639 |
| Molecular Formula | C17H26N2O5S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[3-(2-hydroxyethoxy)propyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCCOCCO)C1CCCN(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C17H26N2O5S/c20-11-13-24-12-5-9-18-17(21)15-6-4-10-19(14-15)25(22,23)16-7-2-1-3-8-16/h1-3,7-8,15,20H,4-6,9-14H2,(H,18,21) |
| InChIKey | ZJDAZURSXRUYBB-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|