C21H25N3O3 — CID 7665428
2-[(Z)-[2-(2,4-dimethylanilino)-2-oxoethylidene]amino]oxy-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 7665428) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-[(Z)-[2-(2,4-dimethylanilino)-2-oxoethylidene]amino]oxy-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[(Z)-[2-(2,4-dimethylanilino)-2-oxoethylidene]amino]oxy-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 7665428 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 2-[(Z)-[2-(2,4-dimethylanilino)-2-oxoethylidene]amino]oxy-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)/C=N\OCC(=O)Nc2ccc(C(C)C)cc2)c(C)c1 |
| InChI | InChI=1S/C21H25N3O3/c1-14(2)17-6-8-18(9-7-17)23-21(26)13-27-22-12-20(25)24-19-10-5-15(3)11-16(19)4/h5-12,14H,13H2,1-4H3,(H,23,26)(H,24,25)/b22-12- |
| InChIKey | MHTNGDFCJYWALK-UUYOSTAYSA-N |
| XLogP | 4.01 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|