About (2Z)-N-(2,4-dimethylphenyl)-2-[2-(4-fluorophenoxy)ethoxyimino]acetamide
(2Z)-N-(2,4-dimethylphenyl)-2-[2-(4-fluorophenoxy)ethoxyimino]acetamide (PubChem CID 7666059) has the molecular formula C18H19FN2O3
and a molecular weight of 330.36 g/mol. Its IUPAC name is (2Z)-N-(2,4-dimethylphenyl)-2-[2-(4-fluorophenoxy)ethoxyimino]acetamide.
Molecular Properties
| Compound Name | (2Z)-N-(2,4-dimethylphenyl)-2-[2-(4-fluorophenoxy)ethoxyimino]acetamide |
| PubChem CID | 7666059 |
| Molecular Formula | C18H19FN2O3 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | (2Z)-N-(2,4-dimethylphenyl)-2-[2-(4-fluorophenoxy)ethoxyimino]acetamide |
| SMILES | Cc1ccc(NC(=O)/C=N\OCCOc2ccc(F)cc2)c(C)c1 |
| InChI | InChI=1S/C18H19FN2O3/c1-13-3-8-17(14(2)11-13)21-18(22)12-20-24-10-9-23-16-6-4-15(19)5-7-16/h3-8,11-12H,9-10H2,1-2H3,(H,21,22)/b20-12- |
| InChIKey | UGSZSXNBROEKDQ-NDENLUEZSA-N |
| XLogP | 3.46 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-N-(2,4-dimethylphenyl)-2-[2-(4-fluorophenoxy)ethoxyimino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-N-(2,4-dimethylphenyl)-2-[2-(4-fluorophenoxy)ethoxyimino]acetamide?
The IUPAC name of (2Z)-N-(2,4-dimethylphenyl)-2-[2-(4-fluorophenoxy)ethoxyimino]acetamide (CID 7666059) is (2Z)-N-(2,4-dimethylphenyl)-2-[2-(4-fluorophenoxy)ethoxyimino]acetamide.
What is the SMILES notation for (2Z)-N-(2,4-dimethylphenyl)-2-[2-(4-fluorophenoxy)ethoxyimino]acetamide?
The canonical SMILES for (2Z)-N-(2,4-dimethylphenyl)-2-[2-(4-fluorophenoxy)ethoxyimino]acetamide is Cc1ccc(NC(=O)/C=N\OCCOc2ccc(F)cc2)c(C)c1.
What is the InChIKey of (2Z)-N-(2,4-dimethylphenyl)-2-[2-(4-fluorophenoxy)ethoxyimino]acetamide?
The InChIKey is UGSZSXNBROEKDQ-NDENLUEZSA-N. The full InChI is InChI=1S/C18H19FN2O3/c1-13-3-8-17(14(2)11-13)21-18(22)12-20-24-10-9-23-16-6-4-15(19)5-7-16/h3-8,11-12H,9-10H2,1-2H3,(H,21,22)/b20-12-.
What are the key properties of (2Z)-N-(2,4-dimethylphenyl)-2-[2-(4-fluorophenoxy)ethoxyimino]acetamide?
(2Z)-N-(2,4-dimethylphenyl)-2-[2-(4-fluorophenoxy)ethoxyimino]acetamide has a molecular weight of 330.36 g/mol, XLogP of 3.46, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-N-(2,4-dimethylphenyl)-2-[2-(4-fluorophenoxy)ethoxyimino]acetamide is sourced from PubChem (CID 7666059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).