C14H14F2N4O3 — CID 71849855
N-(2,4-difluorophenyl)-2-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methoxyimino]acetamide (PubChem CID 71849855) has the molecular formula C14H14F2N4O3 and a molecular weight of 324.29 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methoxyimino]acetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methoxyimino]acetamide |
|---|---|
| PubChem CID | 71849855 |
| Molecular Formula | C14H14F2N4O3 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methoxyimino]acetamide |
| SMILES | CC(C)c1nnc(CON=CC(=O)Nc2ccc(F)cc2F)o1 |
| InChI | InChI=1S/C14H14F2N4O3/c1-8(2)14-20-19-13(23-14)7-22-17-6-12(21)18-11-4-3-9(15)5-10(11)16/h3-6,8H,7H2,1-2H3,(H,18,21) |
| InChIKey | LNAWWWAQBPOJNU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|