C13H9BrF2N2O2S — CID 75404376
(2E)-2-[(5-bromothiophen-3-yl)methoxyimino]-N-(2,4-difluorophenyl)acetamide (PubChem CID 75404376) has the molecular formula C13H9BrF2N2O2S and a molecular weight of 375.19 g/mol. Its IUPAC name is (2E)-2-[(5-bromothiophen-3-yl)methoxyimino]-N-(2,4-difluorophenyl)acetamide.
| Compound Name | (2E)-2-[(5-bromothiophen-3-yl)methoxyimino]-N-(2,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 75404376 |
| Molecular Formula | C13H9BrF2N2O2S |
| Molecular Weight | 375.19 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | (2E)-2-[(5-bromothiophen-3-yl)methoxyimino]-N-(2,4-difluorophenyl)acetamide |
| SMILES | O=C(/C=N/OCc1csc(Br)c1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C13H9BrF2N2O2S/c14-12-3-8(7-21-12)6-20-17-5-13(19)18-11-2-1-9(15)4-10(11)16/h1-5,7H,6H2,(H,18,19)/b17-5+ |
| InChIKey | YPIIUNUJHHVZOY-YAXRCOADSA-N |
| XLogP | 3.93 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.19 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|