C18H14F2N4O3 — CID 76865743
N-(2,4-difluorophenyl)-2-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methoxyimino]acetamide (PubChem CID 76865743) has the molecular formula C18H14F2N4O3 and a molecular weight of 372.33 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methoxyimino]acetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methoxyimino]acetamide |
|---|---|
| PubChem CID | 76865743 |
| Molecular Formula | C18H14F2N4O3 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methoxyimino]acetamide |
| SMILES | Cc1ccc(-c2nnc(CON=CC(=O)Nc3ccc(F)cc3F)o2)cc1 |
| InChI | InChI=1S/C18H14F2N4O3/c1-11-2-4-12(5-3-11)18-24-23-17(27-18)10-26-21-9-16(25)22-15-7-6-13(19)8-14(15)20/h2-9H,10H2,1H3,(H,22,25) |
| InChIKey | QPVJVRPWBZGVIL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|