C22H24N2OS — CID 46614583
2-[methyl-[(4-methylphenyl)methyl]amino]-N-[phenyl(thiophen-2-yl)methyl]acetamide (PubChem CID 46614583) has the molecular formula C22H24N2OS and a molecular weight of 364.51 g/mol. Its IUPAC name is 2-[methyl-[(4-methylphenyl)methyl]amino]-N-[phenyl(thiophen-2-yl)methyl]acetamide.
| Compound Name | 2-[methyl-[(4-methylphenyl)methyl]amino]-N-[phenyl(thiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 46614583 |
| Molecular Formula | C22H24N2OS |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-[methyl-[(4-methylphenyl)methyl]amino]-N-[phenyl(thiophen-2-yl)methyl]acetamide |
| SMILES | Cc1ccc(CN(C)CC(=O)NC(c2ccccc2)c2cccs2)cc1 |
| InChI | InChI=1S/C22H24N2OS/c1-17-10-12-18(13-11-17)15-24(2)16-21(25)23-22(20-9-6-14-26-20)19-7-4-3-5-8-19/h3-14,22H,15-16H2,1-2H3,(H,23,25) |
| InChIKey | IJTXNWIGODIUJI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |