C21H22N2OS — CID 17499470
2-(2,5-dimethylanilino)-N-[phenyl(thiophen-2-yl)methyl]acetamide (PubChem CID 17499470) has the molecular formula C21H22N2OS and a molecular weight of 350.49 g/mol. Its IUPAC name is 2-(2,5-dimethylanilino)-N-[phenyl(thiophen-2-yl)methyl]acetamide.
| Compound Name | 2-(2,5-dimethylanilino)-N-[phenyl(thiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 17499470 |
| Molecular Formula | C21H22N2OS |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-(2,5-dimethylanilino)-N-[phenyl(thiophen-2-yl)methyl]acetamide |
| SMILES | Cc1ccc(C)c(NCC(=O)NC(c2ccccc2)c2cccs2)c1 |
| InChI | InChI=1S/C21H22N2OS/c1-15-10-11-16(2)18(13-15)22-14-20(24)23-21(19-9-6-12-25-19)17-7-4-3-5-8-17/h3-13,21-22H,14H2,1-2H3,(H,23,24) |
| InChIKey | SSWHTPIEBRLRGJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |