C21H21NO2S — CID 24682654
2-(2-methoxy-5-methylphenyl)-N-[phenyl(thiophen-2-yl)methyl]acetamide (PubChem CID 24682654) has the molecular formula C21H21NO2S and a molecular weight of 351.47 g/mol. Its IUPAC name is 2-(2-methoxy-5-methylphenyl)-N-[phenyl(thiophen-2-yl)methyl]acetamide.
| Compound Name | 2-(2-methoxy-5-methylphenyl)-N-[phenyl(thiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 24682654 |
| Molecular Formula | C21H21NO2S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-(2-methoxy-5-methylphenyl)-N-[phenyl(thiophen-2-yl)methyl]acetamide |
| SMILES | COc1ccc(C)cc1CC(=O)NC(c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C21H21NO2S/c1-15-10-11-18(24-2)17(13-15)14-20(23)22-21(19-9-6-12-25-19)16-7-4-3-5-8-16/h3-13,21H,14H2,1-2H3,(H,22,23) |
| InChIKey | FLIDOWRBEVLMKV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |