C21H19N5OS — CID 46607871
2-[5-(4-methylphenyl)tetrazol-2-yl]-N-[phenyl(thiophen-2-yl)methyl]acetamide (PubChem CID 46607871) has the molecular formula C21H19N5OS and a molecular weight of 389.48 g/mol. Its IUPAC name is 2-[5-(4-methylphenyl)tetrazol-2-yl]-N-[phenyl(thiophen-2-yl)methyl]acetamide.
| Compound Name | 2-[5-(4-methylphenyl)tetrazol-2-yl]-N-[phenyl(thiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 46607871 |
| Molecular Formula | C21H19N5OS |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2-[5-(4-methylphenyl)tetrazol-2-yl]-N-[phenyl(thiophen-2-yl)methyl]acetamide |
| SMILES | Cc1ccc(-c2nnn(CC(=O)NC(c3ccccc3)c3cccs3)n2)cc1 |
| InChI | InChI=1S/C21H19N5OS/c1-15-9-11-17(12-10-15)21-23-25-26(24-21)14-19(27)22-20(18-8-5-13-28-18)16-6-3-2-4-7-16/h2-13,20H,14H2,1H3,(H,22,27) |
| InChIKey | HHUIYCZJZLVXNS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |