C20H16ClN5OS — CID 8685781
2-[5-(2-chlorophenyl)tetrazol-2-yl]-N-[(S)-phenyl(thiophen-2-yl)methyl]acetamide (PubChem CID 8685781) has the molecular formula C20H16ClN5OS and a molecular weight of 409.90 g/mol. Its IUPAC name is 2-[5-(2-chlorophenyl)tetrazol-2-yl]-N-[(S)-phenyl(thiophen-2-yl)methyl]acetamide.
| Compound Name | 2-[5-(2-chlorophenyl)tetrazol-2-yl]-N-[(S)-phenyl(thiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 8685781 |
| Molecular Formula | C20H16ClN5OS |
| Molecular Weight | 409.90 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 2-[5-(2-chlorophenyl)tetrazol-2-yl]-N-[(S)-phenyl(thiophen-2-yl)methyl]acetamide |
| SMILES | O=C(Cn1nnc(-c2ccccc2Cl)n1)N[C@@H](c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C20H16ClN5OS/c21-16-10-5-4-9-15(16)20-23-25-26(24-20)13-18(27)22-19(17-11-6-12-28-17)14-7-2-1-3-8-14/h1-12,19H,13H2,(H,22,27)/t19-/m0/s1 |
| InChIKey | QQXNODKOQVMYLU-IBGZPJMESA-N |
| XLogP | 3.96 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.90 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |