C9H6ClN4O2- — CID 6922149
2-[5-(2-chlorophenyl)tetrazol-2-yl]acetate (PubChem CID 6922149) has the molecular formula C9H6ClN4O2- and a molecular weight of 237.63 g/mol. Its IUPAC name is 2-[5-(2-chlorophenyl)tetrazol-2-yl]acetate.
| Compound Name | 2-[5-(2-chlorophenyl)tetrazol-2-yl]acetate |
|---|---|
| PubChem CID | 6922149 |
| Molecular Formula | C9H6ClN4O2- |
| Molecular Weight | 237.63 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 2-[5-(2-chlorophenyl)tetrazol-2-yl]acetate |
| SMILES | O=C([O-])Cn1nnc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C9H7ClN4O2/c10-7-4-2-1-3-6(7)9-11-13-14(12-9)5-8(15)16/h1-4H,5H2,(H,15,16)/p-1 |
| InChIKey | XTEQROKRTGIKDV-UHFFFAOYSA-M |
| XLogP | -0.26 |
| TPSA | 83.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.63 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |