C25H24N6O2 — CID 24594294
2-[[2-[5-(4-methylphenyl)tetrazol-2-yl]acetyl]amino]-N-(1-phenylethyl)benzamide (PubChem CID 24594294) has the molecular formula C25H24N6O2 and a molecular weight of 440.51 g/mol. Its IUPAC name is 2-[[2-[5-(4-methylphenyl)tetrazol-2-yl]acetyl]amino]-N-(1-phenylethyl)benzamide.
| Compound Name | 2-[[2-[5-(4-methylphenyl)tetrazol-2-yl]acetyl]amino]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 24594294 |
| Molecular Formula | C25H24N6O2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 2-[[2-[5-(4-methylphenyl)tetrazol-2-yl]acetyl]amino]-N-(1-phenylethyl)benzamide |
| SMILES | Cc1ccc(-c2nnn(CC(=O)Nc3ccccc3C(=O)NC(C)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C25H24N6O2/c1-17-12-14-20(15-13-17)24-28-30-31(29-24)16-23(32)27-22-11-7-6-10-21(22)25(33)26-18(2)19-8-4-3-5-9-19/h3-15,18H,16H2,1-2H3,(H,26,33)(H,27,32) |
| InChIKey | HOJWZVHBJZQBMW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |