C23H29N3O3 — CID 51170473
2-[[2-(2,6-dimethylmorpholin-4-yl)acetyl]amino]-N-(1-phenylethyl)benzamide (PubChem CID 51170473) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is 2-[[2-(2,6-dimethylmorpholin-4-yl)acetyl]amino]-N-(1-phenylethyl)benzamide.
| Compound Name | 2-[[2-(2,6-dimethylmorpholin-4-yl)acetyl]amino]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 51170473 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 2-[[2-(2,6-dimethylmorpholin-4-yl)acetyl]amino]-N-(1-phenylethyl)benzamide |
| SMILES | CC1CN(CC(=O)Nc2ccccc2C(=O)NC(C)c2ccccc2)CC(C)O1 |
| InChI | InChI=1S/C23H29N3O3/c1-16-13-26(14-17(2)29-16)15-22(27)25-21-12-8-7-11-20(21)23(28)24-18(3)19-9-5-4-6-10-19/h4-12,16-18H,13-15H2,1-3H3,(H,24,28)(H,25,27) |
| InChIKey | KKFHKBMCSPGRBH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |