C17H22N2OS2 — CID 26515915
2-[methyl-[(4-methylsulfanylphenyl)methyl]amino]-N-[(1S)-1-thiophen-2-ylethyl]acetamide (PubChem CID 26515915) has the molecular formula C17H22N2OS2 and a molecular weight of 334.51 g/mol. Its IUPAC name is 2-[methyl-[(4-methylsulfanylphenyl)methyl]amino]-N-[(1S)-1-thiophen-2-ylethyl]acetamide.
| Compound Name | 2-[methyl-[(4-methylsulfanylphenyl)methyl]amino]-N-[(1S)-1-thiophen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 26515915 |
| Molecular Formula | C17H22N2OS2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 2-[methyl-[(4-methylsulfanylphenyl)methyl]amino]-N-[(1S)-1-thiophen-2-ylethyl]acetamide |
| SMILES | CSc1ccc(CN(C)CC(=O)N[C@@H](C)c2cccs2)cc1 |
| InChI | InChI=1S/C17H22N2OS2/c1-13(16-5-4-10-22-16)18-17(20)12-19(2)11-14-6-8-15(21-3)9-7-14/h4-10,13H,11-12H2,1-3H3,(H,18,20)/t13-/m0/s1 |
| InChIKey | SNMPXBNJAPRRQF-ZDUSSCGKSA-N |
| XLogP | 3.78 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |