C21H21NOS — CID 7669881
N-[(R)-(4-ethylphenyl)-thiophen-2-ylmethyl]-2-phenylacetamide (PubChem CID 7669881) has the molecular formula C21H21NOS and a molecular weight of 335.47 g/mol. Its IUPAC name is N-[(R)-(4-ethylphenyl)-thiophen-2-ylmethyl]-2-phenylacetamide.
| Compound Name | N-[(R)-(4-ethylphenyl)-thiophen-2-ylmethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 7669881 |
| Molecular Formula | C21H21NOS |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-[(R)-(4-ethylphenyl)-thiophen-2-ylmethyl]-2-phenylacetamide |
| SMILES | CCc1ccc([C@@H](NC(=O)Cc2ccccc2)c2cccs2)cc1 |
| InChI | InChI=1S/C21H21NOS/c1-2-16-10-12-18(13-11-16)21(19-9-6-14-24-19)22-20(23)15-17-7-4-3-5-8-17/h3-14,21H,2,15H2,1H3,(H,22,23)/t21-/m1/s1 |
| InChIKey | JAHKSISAVYMQSI-OAQYLSRUSA-N |
| XLogP | 4.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |